C10H11NO2 — CID 102086681
(3R)-3-hydroxy-1,3-dimethylindol-2-one (PubChem CID 102086681) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (3R)-3-hydroxy-1,3-dimethylindol-2-one.
| Compound Name | (3R)-3-hydroxy-1,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 102086681 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (3R)-3-hydroxy-1,3-dimethylindol-2-one |
| SMILES | CN1C(=O)[C@](C)(O)c2ccccc21 |
| InChI | InChI=1S/C10H11NO2/c1-10(13)7-5-3-4-6-8(7)11(2)9(10)12/h3-6,13H,1-2H3/t10-/m1/s1 |
| InChIKey | KKYJEHMJKVIBOB-SNVBAGLBSA-N |
| XLogP | 0.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |