C12H13NO2 — CID 102309588
1,3',3'-trimethylspiro[indole-3,2'-oxirane]-2-one (PubChem CID 102309588) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 1,3',3'-trimethylspiro[indole-3,2'-oxirane]-2-one.
| Compound Name | 1,3',3'-trimethylspiro[indole-3,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 102309588 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 1,3',3'-trimethylspiro[indole-3,2'-oxirane]-2-one |
| SMILES | CN1C(=O)C2(OC2(C)C)c2ccccc21 |
| InChI | InChI=1S/C12H13NO2/c1-11(2)12(15-11)8-6-4-5-7-9(8)13(3)10(12)14/h4-7H,1-3H3 |
| InChIKey | QUYGFNSRLIDDOF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|