C11H11NO — CID 14317864
1'-methylspiro[cyclopropane-1,3'-indole]-2'-one (PubChem CID 14317864) has the molecular formula C11H11NO and a molecular weight of 173.22 g/mol. Its IUPAC name is 1'-methylspiro[cyclopropane-1,3'-indole]-2'-one.
| Compound Name | 1'-methylspiro[cyclopropane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 14317864 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 1'-methylspiro[cyclopropane-1,3'-indole]-2'-one |
| SMILES | CN1C(=O)C2(CC2)c2ccccc21 |
| InChI | InChI=1S/C11H11NO/c1-12-9-5-3-2-4-8(9)11(6-7-11)10(12)13/h2-5H,6-7H2,1H3 |
| InChIKey | YBAZVPWAKGZGCQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |