C14H17N3O2 — CID 57097431
1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-carboxamide (PubChem CID 57097431) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-carboxamide.
| Compound Name | 1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 57097431 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 1-methyl-2-oxospiro[indole-3,4'-piperidine]-1'-carboxamide |
| SMILES | CN1C(=O)C2(CCN(C(N)=O)CC2)c2ccccc21 |
| InChI | InChI=1S/C14H17N3O2/c1-16-11-5-3-2-4-10(11)14(12(16)18)6-8-17(9-7-14)13(15)19/h2-5H,6-9H2,1H3,(H2,15,19) |
| InChIKey | VTKLBVTZZLCOJN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |