C16H20N2O2 — CID 53177130
1'-butanoyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one (PubChem CID 53177130) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1'-butanoyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one.
| Compound Name | 1'-butanoyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 53177130 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1'-butanoyl-1-methylspiro[indole-3,3'-pyrrolidine]-2-one |
| SMILES | CCCC(=O)N1CCC2(C1)C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C16H20N2O2/c1-3-6-14(19)18-10-9-16(11-18)12-7-4-5-8-13(12)17(2)15(16)20/h4-5,7-8H,3,6,9-11H2,1-2H3 |
| InChIKey | RCWDEFYEZZZTPW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |