C19H25N3O3 — CID 95718613
N-[4-[(3S)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]-4-oxobutyl]acetamide (PubChem CID 95718613) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[4-[(3S)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]-4-oxobutyl]acetamide.
| Compound Name | N-[4-[(3S)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]-4-oxobutyl]acetamide |
|---|---|
| PubChem CID | 95718613 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[4-[(3S)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]-4-oxobutyl]acetamide |
| SMILES | CC(=O)NCCCC(=O)N1CCC[C@]2(C1)C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C19H25N3O3/c1-14(23)20-11-5-9-17(24)22-12-6-10-19(13-22)15-7-3-4-8-16(15)21(2)18(19)25/h3-4,7-8H,5-6,9-13H2,1-2H3,(H,20,23)/t19-/m1/s1 |
| InChIKey | BUDMDGOROQPTJO-LJQANCHMSA-N |
| XLogP | 1.44 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|