C15H19N3O2 — CID 95709226
2-[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]acetamide (PubChem CID 95709226) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]acetamide.
| Compound Name | 2-[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]acetamide |
|---|---|
| PubChem CID | 95709226 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]acetamide |
| SMILES | CN1C(=O)[C@]2(CCCN(CC(N)=O)C2)c2ccccc21 |
| InChI | InChI=1S/C15H19N3O2/c1-17-12-6-3-2-5-11(12)15(14(17)20)7-4-8-18(10-15)9-13(16)19/h2-3,5-6H,4,7-10H2,1H3,(H2,16,19)/t15-/m0/s1 |
| InChIKey | RFPWCQNKUBCFMX-HNNXBMFYSA-N |
| XLogP | 0.48 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |