About ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate
ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate (PubChem CID 95710662) has the molecular formula C21H24N2O4
and a molecular weight of 368.43 g/mol. Its IUPAC name is ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate |
| PubChem CID | 95710662 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(CN2CCC[C@@]3(C2)C(=O)N(C)c2ccccc23)o1 |
| InChI | InChI=1S/C21H24N2O4/c1-3-26-19(24)18-10-9-15(27-18)13-23-12-6-11-21(14-23)16-7-4-5-8-17(16)22(2)20(21)25/h4-5,7-10H,3,6,11-14H2,1-2H3/t21-/m0/s1 |
| InChIKey | QNJLRZDINLVZFB-NRFANRHFSA-N |
| XLogP | 2.97 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate?
The IUPAC name of ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate (CID 95710662) is ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate.
What is the SMILES notation for ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate?
The canonical SMILES for ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate is CCOC(=O)c1ccc(CN2CCC[C@@]3(C2)C(=O)N(C)c2ccccc23)o1.
What is the InChIKey of ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate?
The InChIKey is QNJLRZDINLVZFB-NRFANRHFSA-N. The full InChI is InChI=1S/C21H24N2O4/c1-3-26-19(24)18-10-9-15(27-18)13-23-12-6-11-21(14-23)16-7-4-5-8-17(16)22(2)20(21)25/h4-5,7-10H,3,6,11-14H2,1-2H3/t21-/m0/s1.
What are the key properties of ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate?
ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate has a molecular weight of 368.43 g/mol, XLogP of 2.97, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[[(3R)-1-methyl-2-oxospiro[indole-3,3'-piperidine]-1'-yl]methyl]furan-2-carboxylate is sourced from PubChem (CID 95710662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).