C19H24N2O3 — CID 91914380
1-methyl-1'-(oxane-4-carbonyl)spiro[indole-3,4'-piperidine]-2-one (PubChem CID 91914380) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-methyl-1'-(oxane-4-carbonyl)spiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 1-methyl-1'-(oxane-4-carbonyl)spiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 91914380 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-methyl-1'-(oxane-4-carbonyl)spiro[indole-3,4'-piperidine]-2-one |
| SMILES | CN1C(=O)C2(CCN(C(=O)C3CCOCC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C19H24N2O3/c1-20-16-5-3-2-4-15(16)19(18(20)23)8-10-21(11-9-19)17(22)14-6-12-24-13-7-14/h2-5,14H,6-13H2,1H3 |
| InChIKey | KSAUDDJHMMQXJO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |