About CID 6954753
CID 6954753 (PubChem CID 6954753) has the molecular formula C16H21N2O+
and a molecular weight of 257.36 g/mol.
Molecular Properties
| Compound Name | CID 6954753 |
| PubChem CID | 6954753 |
| Molecular Formula | C16H21N2O+ |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | — |
| SMILES | CN1C(=O)[C@@]2(CC[NH2+]C23CCCC3)c2ccccc21 |
| InChI | InChI=1S/C16H20N2O/c1-18-13-7-3-2-6-12(13)16(14(18)19)10-11-17-15(16)8-4-5-9-15/h2-3,6-7,17H,4-5,8-11H2,1H3/p+1/t16-/m1/s1 |
| InChIKey | QXWBITMBUVPYMS-MRXNPFEDSA-O |
| XLogP | 1.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 6954753 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6954753?
The IUPAC name of CID 6954753 (CID 6954753) is not available.
What is the SMILES notation for CID 6954753?
The canonical SMILES for CID 6954753 is CN1C(=O)[C@@]2(CC[NH2+]C23CCCC3)c2ccccc21.
What is the InChIKey of CID 6954753?
The InChIKey is QXWBITMBUVPYMS-MRXNPFEDSA-O. The full InChI is InChI=1S/C16H20N2O/c1-18-13-7-3-2-6-12(13)16(14(18)19)10-11-17-15(16)8-4-5-9-15/h2-3,6-7,17H,4-5,8-11H2,1H3/p+1/t16-/m1/s1.
What are the key properties of CID 6954753?
CID 6954753 has a molecular weight of 257.36 g/mol, XLogP of 1.18, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6954753 is sourced from PubChem (CID 6954753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).