About CID 164582213
CID 164582213 (PubChem CID 164582213) has the molecular formula C16H19NO3
and a molecular weight of 273.33 g/mol.
Molecular Properties
| Compound Name | CID 164582213 |
| PubChem CID | 164582213 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | — |
| SMILES | CN1C(=O)C2(CCC3(CC2)OCCO3)c2ccccc21 |
| InChI | InChI=1S/C16H19NO3/c1-17-13-5-3-2-4-12(13)15(14(17)18)6-8-16(9-7-15)19-10-11-20-16/h2-5H,6-11H2,1H3 |
| InChIKey | DQUDBACBOKJXKH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 164582213 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164582213?
The IUPAC name of CID 164582213 (CID 164582213) is not available.
What is the SMILES notation for CID 164582213?
The canonical SMILES for CID 164582213 is CN1C(=O)C2(CCC3(CC2)OCCO3)c2ccccc21.
What is the InChIKey of CID 164582213?
The InChIKey is DQUDBACBOKJXKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3/c1-17-13-5-3-2-4-12(13)15(14(17)18)6-8-16(9-7-15)19-10-11-20-16/h2-5H,6-11H2,1H3.
What are the key properties of CID 164582213?
CID 164582213 has a molecular weight of 273.33 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164582213 is sourced from PubChem (CID 164582213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).