About CID 44654608
CID 44654608 (PubChem CID 44654608) has the molecular formula C22H25ClN2O
and a molecular weight of 368.91 g/mol.
Molecular Properties
| Compound Name | CID 44654608 |
| PubChem CID | 44654608 |
| Molecular Formula | C22H25ClN2O |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | — |
| SMILES | O=C1N(Cc2ccccc2)c2ccccc2C12CC[NH2+]C21CCCC1.[Cl-] |
| InChI | InChI=1S/C22H24N2O.ClH/c25-20-22(14-15-23-21(22)12-6-7-13-21)18-10-4-5-11-19(18)24(20)16-17-8-2-1-3-9-17;/h1-5,8-11,23H,6-7,12-16H2;1H |
| InChIKey | VGYBGNMCFWDHKH-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 44654608 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 44654608?
The IUPAC name of CID 44654608 (CID 44654608) is not available.
What is the SMILES notation for CID 44654608?
The canonical SMILES for CID 44654608 is O=C1N(Cc2ccccc2)c2ccccc2C12CC[NH2+]C21CCCC1.[Cl-].
What is the InChIKey of CID 44654608?
The InChIKey is VGYBGNMCFWDHKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O.ClH/c25-20-22(14-15-23-21(22)12-6-7-13-21)18-10-4-5-11-19(18)24(20)16-17-8-2-1-3-9-17;/h1-5,8-11,23H,6-7,12-16H2;1H.
What are the key properties of CID 44654608?
CID 44654608 has a molecular weight of 368.91 g/mol, XLogP of -0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 44654608 is sourced from PubChem (CID 44654608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).