C25H23NO — CID 102179958
(3R)-1,3-dibenzyl-3-prop-2-enylindol-2-one (PubChem CID 102179958) has the molecular formula C25H23NO and a molecular weight of 353.47 g/mol. Its IUPAC name is (3R)-1,3-dibenzyl-3-prop-2-enylindol-2-one.
| Compound Name | (3R)-1,3-dibenzyl-3-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 102179958 |
| Molecular Formula | C25H23NO |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (3R)-1,3-dibenzyl-3-prop-2-enylindol-2-one |
| SMILES | C=CC[C@]1(Cc2ccccc2)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H23NO/c1-2-17-25(18-20-11-5-3-6-12-20)22-15-9-10-16-23(22)26(24(25)27)19-21-13-7-4-8-14-21/h2-16H,1,17-19H2/t25-/m1/s1 |
| InChIKey | FGQKJPLDBRJXOB-RUZDIDTESA-N |
| XLogP | 5.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|