C17H15NO3 — CID 7036178
1'-benzylspiro[1,3-dioxolane-2,3'-indole]-2'-one (PubChem CID 7036178) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1'-benzylspiro[1,3-dioxolane-2,3'-indole]-2'-one.
| Compound Name | 1'-benzylspiro[1,3-dioxolane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 7036178 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 1'-benzylspiro[1,3-dioxolane-2,3'-indole]-2'-one |
| SMILES | O=C1N(Cc2ccccc2)c2ccccc2C12OCCO2 |
| InChI | InChI=1S/C17H15NO3/c19-16-17(20-10-11-21-17)14-8-4-5-9-15(14)18(16)12-13-6-2-1-3-7-13/h1-9H,10-12H2 |
| InChIKey | VHZGWEHDOSHOQU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |