C23H27NO4 — CID 18884261
1'-[(4-pentoxyphenyl)methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 18884261) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 1'-[(4-pentoxyphenyl)methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 1'-[(4-pentoxyphenyl)methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 18884261 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1'-[(4-pentoxyphenyl)methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CCCCCOc1ccc(CN2C(=O)C3(OCCCO3)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-2-3-6-14-26-19-12-10-18(11-13-19)17-24-21-9-5-4-8-20(21)23(22(24)25)27-15-7-16-28-23/h4-5,8-13H,2-3,6-7,14-17H2,1H3 |
| InChIKey | ARKMTSGPXBRXKL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|