C22H24ClNO4 — CID 9196261
1'-[(2-butoxyphenyl)methyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 9196261) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is 1'-[(2-butoxyphenyl)methyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 1'-[(2-butoxyphenyl)methyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 9196261 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 1'-[(2-butoxyphenyl)methyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CCCCOc1ccccc1CN1C(=O)C2(OCCCO2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H24ClNO4/c1-2-3-11-26-20-8-5-4-7-16(20)15-24-19-10-9-17(23)14-18(19)22(21(24)25)27-12-6-13-28-22/h4-5,7-10,14H,2-3,6,11-13,15H2,1H3 |
| InChIKey | OZYQSXISIKMFTI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|