C24H28ClNO5 — CID 18884339
5'-chloro-1'-[(3-methoxy-4-pentoxyphenyl)methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 18884339) has the molecular formula C24H28ClNO5 and a molecular weight of 445.94 g/mol. Its IUPAC name is 5'-chloro-1'-[(3-methoxy-4-pentoxyphenyl)methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 5'-chloro-1'-[(3-methoxy-4-pentoxyphenyl)methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 18884339 |
| Molecular Formula | C24H28ClNO5 |
| Molecular Weight | 445.94 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 5'-chloro-1'-[(3-methoxy-4-pentoxyphenyl)methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CCCCCOc1ccc(CN2C(=O)C3(OCCCO3)c3cc(Cl)ccc32)cc1OC |
| InChI | InChI=1S/C24H28ClNO5/c1-3-4-5-11-29-21-10-7-17(14-22(21)28-2)16-26-20-9-8-18(25)15-19(20)24(23(26)27)30-12-6-13-31-24/h7-10,14-15H,3-6,11-13,16H2,1-2H3 |
| InChIKey | QQFIRGHGLFBAJD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.94 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|