C25H31NO5 — CID 9177543
1'-[(4-butoxy-3-methoxyphenyl)methyl]-5',7'-dimethylspiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 9177543) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is 1'-[(4-butoxy-3-methoxyphenyl)methyl]-5',7'-dimethylspiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 1'-[(4-butoxy-3-methoxyphenyl)methyl]-5',7'-dimethylspiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 9177543 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 1'-[(4-butoxy-3-methoxyphenyl)methyl]-5',7'-dimethylspiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CCCCOc1ccc(CN2C(=O)C3(OCCCO3)c3cc(C)cc(C)c32)cc1OC |
| InChI | InChI=1S/C25H31NO5/c1-5-6-10-29-21-9-8-19(15-22(21)28-4)16-26-23-18(3)13-17(2)14-20(23)25(24(26)27)30-11-7-12-31-25/h8-9,13-15H,5-7,10-12,16H2,1-4H3 |
| InChIKey | XXJBDLVATLFCDZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|