C23H25Cl2NO5 — CID 18888667
1-[(4-butoxy-3-methoxyphenyl)methyl]-6,7-dichloro-3-hydroxy-3-(2-oxopropyl)indol-2-one (PubChem CID 18888667) has the molecular formula C23H25Cl2NO5 and a molecular weight of 466.36 g/mol. Its IUPAC name is 1-[(4-butoxy-3-methoxyphenyl)methyl]-6,7-dichloro-3-hydroxy-3-(2-oxopropyl)indol-2-one.
| Compound Name | 1-[(4-butoxy-3-methoxyphenyl)methyl]-6,7-dichloro-3-hydroxy-3-(2-oxopropyl)indol-2-one |
|---|---|
| PubChem CID | 18888667 |
| Molecular Formula | C23H25Cl2NO5 |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 1-[(4-butoxy-3-methoxyphenyl)methyl]-6,7-dichloro-3-hydroxy-3-(2-oxopropyl)indol-2-one |
| SMILES | CCCCOc1ccc(CN2C(=O)C(O)(CC(C)=O)c3ccc(Cl)c(Cl)c32)cc1OC |
| InChI | InChI=1S/C23H25Cl2NO5/c1-4-5-10-31-18-9-6-15(11-19(18)30-3)13-26-21-16(7-8-17(24)20(21)25)23(29,22(26)28)12-14(2)27/h6-9,11,29H,4-5,10,12-13H2,1-3H3 |
| InChIKey | XQRHSZOYENDROY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|