C20H21NO4 — CID 51921804
(3S)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-7-methyl-3-(2-oxopropyl)indol-2-one (PubChem CID 51921804) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (3S)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-7-methyl-3-(2-oxopropyl)indol-2-one.
| Compound Name | (3S)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-7-methyl-3-(2-oxopropyl)indol-2-one |
|---|---|
| PubChem CID | 51921804 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (3S)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-7-methyl-3-(2-oxopropyl)indol-2-one |
| SMILES | COc1ccc(CN2C(=O)[C@](O)(CC(C)=O)c3cccc(C)c32)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-13-5-4-6-17-18(13)21(19(23)20(17,24)11-14(2)22)12-15-7-9-16(25-3)10-8-15/h4-10,24H,11-12H2,1-3H3/t20-/m0/s1 |
| InChIKey | SCKSMAXJNLUXFU-FQEVSTJZSA-N |
| XLogP | 2.72 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |