C26H33NO4 — CID 18888365
1-[(4-hexoxyphenyl)methyl]-3-hydroxy-5,7-dimethyl-3-(2-oxopropyl)indol-2-one (PubChem CID 18888365) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is 1-[(4-hexoxyphenyl)methyl]-3-hydroxy-5,7-dimethyl-3-(2-oxopropyl)indol-2-one.
| Compound Name | 1-[(4-hexoxyphenyl)methyl]-3-hydroxy-5,7-dimethyl-3-(2-oxopropyl)indol-2-one |
|---|---|
| PubChem CID | 18888365 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 1-[(4-hexoxyphenyl)methyl]-3-hydroxy-5,7-dimethyl-3-(2-oxopropyl)indol-2-one |
| SMILES | CCCCCCOc1ccc(CN2C(=O)C(O)(CC(C)=O)c3cc(C)cc(C)c32)cc1 |
| InChI | InChI=1S/C26H33NO4/c1-5-6-7-8-13-31-22-11-9-21(10-12-22)17-27-24-19(3)14-18(2)15-23(24)26(30,25(27)29)16-20(4)28/h9-12,14-15,30H,5-8,13,16-17H2,1-4H3 |
| InChIKey | FHSQMNROCVGQSX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|