C24H27Cl2NO4 — CID 18888600
4,7-dichloro-1-[(4-hexoxyphenyl)methyl]-3-hydroxy-3-(2-oxopropyl)indol-2-one (PubChem CID 18888600) has the molecular formula C24H27Cl2NO4 and a molecular weight of 464.39 g/mol. Its IUPAC name is 4,7-dichloro-1-[(4-hexoxyphenyl)methyl]-3-hydroxy-3-(2-oxopropyl)indol-2-one.
| Compound Name | 4,7-dichloro-1-[(4-hexoxyphenyl)methyl]-3-hydroxy-3-(2-oxopropyl)indol-2-one |
|---|---|
| PubChem CID | 18888600 |
| Molecular Formula | C24H27Cl2NO4 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 4,7-dichloro-1-[(4-hexoxyphenyl)methyl]-3-hydroxy-3-(2-oxopropyl)indol-2-one |
| SMILES | CCCCCCOc1ccc(CN2C(=O)C(O)(CC(C)=O)c3c(Cl)ccc(Cl)c32)cc1 |
| InChI | InChI=1S/C24H27Cl2NO4/c1-3-4-5-6-13-31-18-9-7-17(8-10-18)15-27-22-20(26)12-11-19(25)21(22)24(30,23(27)29)14-16(2)28/h7-12,30H,3-6,13-15H2,1-2H3 |
| InChIKey | GWNLFQYHQHKPHE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|