C16H21NO3 — CID 18888342
3-hydroxy-5,7-dimethyl-3-(2-oxopropyl)-1-propylindol-2-one (PubChem CID 18888342) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-hydroxy-5,7-dimethyl-3-(2-oxopropyl)-1-propylindol-2-one.
| Compound Name | 3-hydroxy-5,7-dimethyl-3-(2-oxopropyl)-1-propylindol-2-one |
|---|---|
| PubChem CID | 18888342 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-hydroxy-5,7-dimethyl-3-(2-oxopropyl)-1-propylindol-2-one |
| SMILES | CCCN1C(=O)C(O)(CC(C)=O)c2cc(C)cc(C)c21 |
| InChI | InChI=1S/C16H21NO3/c1-5-6-17-14-11(3)7-10(2)8-13(14)16(20,15(17)19)9-12(4)18/h7-8,20H,5-6,9H2,1-4H3 |
| InChIKey | YHQYKGVGYMZCAR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |