C15H19NO3 — CID 18888241
1-butyl-3-hydroxy-3-(2-oxopropyl)indol-2-one (PubChem CID 18888241) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-butyl-3-hydroxy-3-(2-oxopropyl)indol-2-one.
| Compound Name | 1-butyl-3-hydroxy-3-(2-oxopropyl)indol-2-one |
|---|---|
| PubChem CID | 18888241 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-butyl-3-hydroxy-3-(2-oxopropyl)indol-2-one |
| SMILES | CCCCN1C(=O)C(O)(CC(C)=O)c2ccccc21 |
| InChI | InChI=1S/C15H19NO3/c1-3-4-9-16-13-8-6-5-7-12(13)15(19,14(16)18)10-11(2)17/h5-8,19H,3-4,9-10H2,1-2H3 |
| InChIKey | LXNHMRXSTLKRNE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |