C24H29NO3 — CID 2056627
(3S)-1-butyl-3-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one (PubChem CID 2056627) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is (3S)-1-butyl-3-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one.
| Compound Name | (3S)-1-butyl-3-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 2056627 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (3S)-1-butyl-3-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
| SMILES | CCCCN1C(=O)[C@](O)(CC(=O)c2ccc(C(C)(C)C)cc2)c2ccccc21 |
| InChI | InChI=1S/C24H29NO3/c1-5-6-15-25-20-10-8-7-9-19(20)24(28,22(25)27)16-21(26)17-11-13-18(14-12-17)23(2,3)4/h7-14,28H,5-6,15-16H2,1-4H3/t24-/m0/s1 |
| InChIKey | ARALTDJIGJRMAW-DEOSSOPVSA-N |
| XLogP | 4.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |