C25H31N2O4+ — CID 5212720
3-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-hydroxy-1-(morpholin-4-ium-4-ylmethyl)indol-2-one (PubChem CID 5212720) has the molecular formula C25H31N2O4+ and a molecular weight of 423.53 g/mol. Its IUPAC name is 3-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-hydroxy-1-(morpholin-4-ium-4-ylmethyl)indol-2-one.
| Compound Name | 3-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-hydroxy-1-(morpholin-4-ium-4-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 5212720 |
| Molecular Formula | C25H31N2O4+ |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 3-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-hydroxy-1-(morpholin-4-ium-4-ylmethyl)indol-2-one |
| SMILES | CC(C)(C)c1ccc(C(=O)CC2(O)C(=O)N(C[NH+]3CCOCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H30N2O4/c1-24(2,3)19-10-8-18(9-11-19)22(28)16-25(30)20-6-4-5-7-21(20)27(23(25)29)17-26-12-14-31-15-13-26/h4-11,30H,12-17H2,1-3H3/p+1 |
| InChIKey | MFDYBPCKVDDNSI-UHFFFAOYSA-O |
| XLogP | 1.66 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |