C21H23N2O4+ — CID 5053139
3-hydroxy-1-(morpholin-4-ium-4-ylmethyl)-3-phenacylindol-2-one (PubChem CID 5053139) has the molecular formula C21H23N2O4+ and a molecular weight of 367.43 g/mol. Its IUPAC name is 3-hydroxy-1-(morpholin-4-ium-4-ylmethyl)-3-phenacylindol-2-one.
| Compound Name | 3-hydroxy-1-(morpholin-4-ium-4-ylmethyl)-3-phenacylindol-2-one |
|---|---|
| PubChem CID | 5053139 |
| Molecular Formula | C21H23N2O4+ |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 3-hydroxy-1-(morpholin-4-ium-4-ylmethyl)-3-phenacylindol-2-one |
| SMILES | O=C(CC1(O)C(=O)N(C[NH+]2CCOCC2)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O4/c24-19(16-6-2-1-3-7-16)14-21(26)17-8-4-5-9-18(17)23(20(21)25)15-22-10-12-27-13-11-22/h1-9,26H,10-15H2/p+1 |
| InChIKey | IDTNGXPTRSXKBA-UHFFFAOYSA-O |
| XLogP | 0.37 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |