C20H23N2O4+ — CID 9350088
(3R)-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(piperidin-1-ium-1-ylmethyl)indol-2-one (PubChem CID 9350088) has the molecular formula C20H23N2O4+ and a molecular weight of 355.41 g/mol. Its IUPAC name is (3R)-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(piperidin-1-ium-1-ylmethyl)indol-2-one.
| Compound Name | (3R)-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(piperidin-1-ium-1-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 9350088 |
| Molecular Formula | C20H23N2O4+ |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (3R)-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(piperidin-1-ium-1-ylmethyl)indol-2-one |
| SMILES | O=C(C[C@]1(O)C(=O)N(C[NH+]2CCCCC2)c2ccccc21)c1ccco1 |
| InChI | InChI=1S/C20H22N2O4/c23-17(18-9-6-12-26-18)13-20(25)15-7-2-3-8-16(15)22(19(20)24)14-21-10-4-1-5-11-21/h2-3,6-9,12,25H,1,4-5,10-11,13-14H2/p+1/t20-/m1/s1 |
| InChIKey | XFAWNVARYKSITM-HXUWFJFHSA-O |
| XLogP | 1.11 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |