C25H19NO4 — CID 2946406
3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(naphthalen-1-ylmethyl)indol-2-one (PubChem CID 2946406) has the molecular formula C25H19NO4 and a molecular weight of 397.43 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(naphthalen-1-ylmethyl)indol-2-one.
| Compound Name | 3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(naphthalen-1-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 2946406 |
| Molecular Formula | C25H19NO4 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1-(naphthalen-1-ylmethyl)indol-2-one |
| SMILES | O=C(CC1(O)C(=O)N(Cc2cccc3ccccc23)c2ccccc21)c1ccco1 |
| InChI | InChI=1S/C25H19NO4/c27-22(23-13-6-14-30-23)15-25(29)20-11-3-4-12-21(20)26(24(25)28)16-18-9-5-8-17-7-1-2-10-19(17)18/h1-14,29H,15-16H2 |
| InChIKey | PREIGEHOAZAZJJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |