C27H21NO4 — CID 40853253
(3S)-3-[(E)-4-(furan-2-yl)-2-oxobut-3-enyl]-3-hydroxy-1-(naphthalen-1-ylmethyl)indol-2-one (PubChem CID 40853253) has the molecular formula C27H21NO4 and a molecular weight of 423.47 g/mol. Its IUPAC name is (3S)-3-[(E)-4-(furan-2-yl)-2-oxobut-3-enyl]-3-hydroxy-1-(naphthalen-1-ylmethyl)indol-2-one.
| Compound Name | (3S)-3-[(E)-4-(furan-2-yl)-2-oxobut-3-enyl]-3-hydroxy-1-(naphthalen-1-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 40853253 |
| Molecular Formula | C27H21NO4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (3S)-3-[(E)-4-(furan-2-yl)-2-oxobut-3-enyl]-3-hydroxy-1-(naphthalen-1-ylmethyl)indol-2-one |
| SMILES | O=C(/C=C/c1ccco1)C[C@@]1(O)C(=O)N(Cc2cccc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C27H21NO4/c29-21(14-15-22-10-6-16-32-22)17-27(31)24-12-3-4-13-25(24)28(26(27)30)18-20-9-5-8-19-7-1-2-11-23(19)20/h1-16,31H,17-18H2/b15-14+/t27-/m0/s1 |
| InChIKey | PHIDDHVJHGYWME-RTHBMQBDSA-N |
| XLogP | 4.84 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|