C19H15NO4 — CID 2190211
(3R)-3-[(Z)-4-(furan-2-yl)-2-oxobut-3-enyl]-3-hydroxy-1-prop-2-ynylindol-2-one (PubChem CID 2190211) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is (3R)-3-[(Z)-4-(furan-2-yl)-2-oxobut-3-enyl]-3-hydroxy-1-prop-2-ynylindol-2-one.
| Compound Name | (3R)-3-[(Z)-4-(furan-2-yl)-2-oxobut-3-enyl]-3-hydroxy-1-prop-2-ynylindol-2-one |
|---|---|
| PubChem CID | 2190211 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (3R)-3-[(Z)-4-(furan-2-yl)-2-oxobut-3-enyl]-3-hydroxy-1-prop-2-ynylindol-2-one |
| SMILES | C#CCN1C(=O)[C@@](O)(CC(=O)/C=C\c2ccco2)c2ccccc21 |
| InChI | InChI=1S/C19H15NO4/c1-2-11-20-17-8-4-3-7-16(17)19(23,18(20)22)13-14(21)9-10-15-6-5-12-24-15/h1,3-10,12,23H,11,13H2/b10-9-/t19-/m1/s1 |
| InChIKey | CTDMJCVOLHIQFS-ZBTAVZRMSA-N |
| XLogP | 2.12 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|