C14H13NO2 — CID 162398841
3-hydroxy-3-prop-2-enyl-1-prop-2-ynylindol-2-one (PubChem CID 162398841) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 3-hydroxy-3-prop-2-enyl-1-prop-2-ynylindol-2-one.
| Compound Name | 3-hydroxy-3-prop-2-enyl-1-prop-2-ynylindol-2-one |
|---|---|
| PubChem CID | 162398841 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3-hydroxy-3-prop-2-enyl-1-prop-2-ynylindol-2-one |
| SMILES | C#CCN1C(=O)C(O)(CC=C)c2ccccc21 |
| InChI | InChI=1S/C14H13NO2/c1-3-9-14(17)11-7-5-6-8-12(11)15(10-4-2)13(14)16/h2-3,5-8,17H,1,9-10H2 |
| InChIKey | NKGJUBLZSMMEKS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|