C17H12ClNO3S — CID 2224257
(3S)-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-1-prop-2-ynylindol-2-one (PubChem CID 2224257) has the molecular formula C17H12ClNO3S and a molecular weight of 345.81 g/mol. Its IUPAC name is (3S)-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-1-prop-2-ynylindol-2-one.
| Compound Name | (3S)-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-1-prop-2-ynylindol-2-one |
|---|---|
| PubChem CID | 2224257 |
| Molecular Formula | C17H12ClNO3S |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | (3S)-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-1-prop-2-ynylindol-2-one |
| SMILES | C#CCN1C(=O)[C@](O)(CC(=O)c2ccc(Cl)s2)c2ccccc21 |
| InChI | InChI=1S/C17H12ClNO3S/c1-2-9-19-12-6-4-3-5-11(12)17(22,16(19)21)10-13(20)14-7-8-15(18)23-14/h1,3-8,22H,9-10H2/t17-/m0/s1 |
| InChIKey | JFGXAMLMALAIMO-KRWDZBQOSA-N |
| XLogP | 2.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|