C23H20ClNO3S — CID 40875194
(3S)-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-1-(3-phenylpropyl)indol-2-one (PubChem CID 40875194) has the molecular formula C23H20ClNO3S and a molecular weight of 425.94 g/mol. Its IUPAC name is (3S)-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-1-(3-phenylpropyl)indol-2-one.
| Compound Name | (3S)-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-1-(3-phenylpropyl)indol-2-one |
|---|---|
| PubChem CID | 40875194 |
| Molecular Formula | C23H20ClNO3S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | (3S)-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxy-1-(3-phenylpropyl)indol-2-one |
| SMILES | O=C(C[C@@]1(O)C(=O)N(CCCc2ccccc2)c2ccccc21)c1ccc(Cl)s1 |
| InChI | InChI=1S/C23H20ClNO3S/c24-21-13-12-20(29-21)19(26)15-23(28)17-10-4-5-11-18(17)25(22(23)27)14-6-9-16-7-2-1-3-8-16/h1-5,7-8,10-13,28H,6,9,14-15H2/t23-/m0/s1 |
| InChIKey | GMBFGQKMSXCRPC-QHCPKHFHSA-N |
| XLogP | 4.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |