C21H16ClNO3S — CID 2956599
1-benzyl-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxyindol-2-one (PubChem CID 2956599) has the molecular formula C21H16ClNO3S and a molecular weight of 397.88 g/mol. Its IUPAC name is 1-benzyl-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxyindol-2-one.
| Compound Name | 1-benzyl-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 2956599 |
| Molecular Formula | C21H16ClNO3S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 1-benzyl-3-[2-(5-chlorothiophen-2-yl)-2-oxoethyl]-3-hydroxyindol-2-one |
| SMILES | O=C(CC1(O)C(=O)N(Cc2ccccc2)c2ccccc21)c1ccc(Cl)s1 |
| InChI | InChI=1S/C21H16ClNO3S/c22-19-11-10-18(27-19)17(24)12-21(26)15-8-4-5-9-16(15)23(20(21)25)13-14-6-2-1-3-7-14/h1-11,26H,12-13H2 |
| InChIKey | NYDPTKQAGODLAQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |