C17H15NO4 — CID 703155
(3R)-3-[(E)-4-(furan-2-yl)-2-oxobut-3-enyl]-3-hydroxy-1-methylindol-2-one (PubChem CID 703155) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is (3R)-3-[(E)-4-(furan-2-yl)-2-oxobut-3-enyl]-3-hydroxy-1-methylindol-2-one.
| Compound Name | (3R)-3-[(E)-4-(furan-2-yl)-2-oxobut-3-enyl]-3-hydroxy-1-methylindol-2-one |
|---|---|
| PubChem CID | 703155 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (3R)-3-[(E)-4-(furan-2-yl)-2-oxobut-3-enyl]-3-hydroxy-1-methylindol-2-one |
| SMILES | CN1C(=O)[C@@](O)(CC(=O)/C=C/c2ccco2)c2ccccc21 |
| InChI | InChI=1S/C17H15NO4/c1-18-15-7-3-2-6-14(15)17(21,16(18)20)11-12(19)8-9-13-5-4-10-22-13/h2-10,21H,11H2,1H3/b9-8+/t17-/m1/s1 |
| InChIKey | ZGLLCPWPHJGYBT-KBOKABMXSA-N |
| XLogP | 2.12 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|