C19H16BrNO3 — CID 93045541
(3S)-5-bromo-3-hydroxy-1-methyl-3-[(Z)-2-oxo-4-phenylbut-3-enyl]indol-2-one (PubChem CID 93045541) has the molecular formula C19H16BrNO3 and a molecular weight of 386.25 g/mol. Its IUPAC name is (3S)-5-bromo-3-hydroxy-1-methyl-3-[(Z)-2-oxo-4-phenylbut-3-enyl]indol-2-one.
| Compound Name | (3S)-5-bromo-3-hydroxy-1-methyl-3-[(Z)-2-oxo-4-phenylbut-3-enyl]indol-2-one |
|---|---|
| PubChem CID | 93045541 |
| Molecular Formula | C19H16BrNO3 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | (3S)-5-bromo-3-hydroxy-1-methyl-3-[(Z)-2-oxo-4-phenylbut-3-enyl]indol-2-one |
| SMILES | CN1C(=O)[C@](O)(CC(=O)/C=C\c2ccccc2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C19H16BrNO3/c1-21-17-10-8-14(20)11-16(17)19(24,18(21)23)12-15(22)9-7-13-5-3-2-4-6-13/h2-11,24H,12H2,1H3/b9-7-/t19-/m0/s1 |
| InChIKey | COTKAJPNMKURPV-FUKPKEADSA-N |
| XLogP | 3.29 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|