C23H18BrNO3 — CID 3366863
5-bromo-3-hydroxy-3-(2-oxo-6-phenylhexa-3,5-dienyl)-1-prop-2-ynylindol-2-one (PubChem CID 3366863) has the molecular formula C23H18BrNO3 and a molecular weight of 436.31 g/mol. Its IUPAC name is 5-bromo-3-hydroxy-3-(2-oxo-6-phenylhexa-3,5-dienyl)-1-prop-2-ynylindol-2-one.
| Compound Name | 5-bromo-3-hydroxy-3-(2-oxo-6-phenylhexa-3,5-dienyl)-1-prop-2-ynylindol-2-one |
|---|---|
| PubChem CID | 3366863 |
| Molecular Formula | C23H18BrNO3 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 5-bromo-3-hydroxy-3-(2-oxo-6-phenylhexa-3,5-dienyl)-1-prop-2-ynylindol-2-one |
| SMILES | C#CCN1C(=O)C(O)(CC(=O)C=CC=Cc2ccccc2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C23H18BrNO3/c1-2-14-25-21-13-12-18(24)15-20(21)23(28,22(25)27)16-19(26)11-7-6-10-17-8-4-3-5-9-17/h1,3-13,15,28H,14,16H2 |
| InChIKey | HBTYZSWKAYJNKB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|