C29H27NO3 — CID 3487364
1-[(2,5-dimethylphenyl)methyl]-3-hydroxy-3-(2-oxo-6-phenylhexa-3,5-dienyl)indol-2-one (PubChem CID 3487364) has the molecular formula C29H27NO3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-[(2,5-dimethylphenyl)methyl]-3-hydroxy-3-(2-oxo-6-phenylhexa-3,5-dienyl)indol-2-one.
| Compound Name | 1-[(2,5-dimethylphenyl)methyl]-3-hydroxy-3-(2-oxo-6-phenylhexa-3,5-dienyl)indol-2-one |
|---|---|
| PubChem CID | 3487364 |
| Molecular Formula | C29H27NO3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 1-[(2,5-dimethylphenyl)methyl]-3-hydroxy-3-(2-oxo-6-phenylhexa-3,5-dienyl)indol-2-one |
| SMILES | Cc1ccc(C)c(CN2C(=O)C(O)(CC(=O)C=CC=Cc3ccccc3)c3ccccc32)c1 |
| InChI | InChI=1S/C29H27NO3/c1-21-16-17-22(2)24(18-21)20-30-27-15-9-8-14-26(27)29(33,28(30)32)19-25(31)13-7-6-12-23-10-4-3-5-11-23/h3-18,33H,19-20H2,1-2H3 |
| InChIKey | PSFVPAFHAATMEL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|