C31H31NO3 — CID 41145256
(3R)-3-hydroxy-1-[(2-methyl-5-propan-2-ylphenyl)methyl]-3-[(3E,5Z)-2-oxo-6-phenylhexa-3,5-dienyl]indol-2-one (PubChem CID 41145256) has the molecular formula C31H31NO3 and a molecular weight of 465.59 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-[(2-methyl-5-propan-2-ylphenyl)methyl]-3-[(3E,5Z)-2-oxo-6-phenylhexa-3,5-dienyl]indol-2-one.
| Compound Name | (3R)-3-hydroxy-1-[(2-methyl-5-propan-2-ylphenyl)methyl]-3-[(3E,5Z)-2-oxo-6-phenylhexa-3,5-dienyl]indol-2-one |
|---|---|
| PubChem CID | 41145256 |
| Molecular Formula | C31H31NO3 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | (3R)-3-hydroxy-1-[(2-methyl-5-propan-2-ylphenyl)methyl]-3-[(3E,5Z)-2-oxo-6-phenylhexa-3,5-dienyl]indol-2-one |
| SMILES | Cc1ccc(C(C)C)cc1CN1C(=O)[C@@](O)(CC(=O)/C=C/C=C\c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C31H31NO3/c1-22(2)25-18-17-23(3)26(19-25)21-32-29-16-10-9-15-28(29)31(35,30(32)34)20-27(33)14-8-7-13-24-11-5-4-6-12-24/h4-19,22,35H,20-21H2,1-3H3/b13-7-,14-8+/t31-/m1/s1 |
| InChIKey | IZTXELMBCWSNIT-RVQXDZDMSA-N |
| XLogP | 6.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|