C22H20N2O4 — CID 92923619
2-[(3R)-3-hydroxy-2-oxo-3-[(3E,5Z)-2-oxo-6-phenylhexa-3,5-dienyl]indol-1-yl]acetamide (PubChem CID 92923619) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-[(3R)-3-hydroxy-2-oxo-3-[(3E,5Z)-2-oxo-6-phenylhexa-3,5-dienyl]indol-1-yl]acetamide.
| Compound Name | 2-[(3R)-3-hydroxy-2-oxo-3-[(3E,5Z)-2-oxo-6-phenylhexa-3,5-dienyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 92923619 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-[(3R)-3-hydroxy-2-oxo-3-[(3E,5Z)-2-oxo-6-phenylhexa-3,5-dienyl]indol-1-yl]acetamide |
| SMILES | NC(=O)CN1C(=O)[C@@](O)(CC(=O)/C=C/C=C\c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C22H20N2O4/c23-20(26)15-24-19-13-7-6-12-18(19)22(28,21(24)27)14-17(25)11-5-4-10-16-8-2-1-3-9-16/h1-13,28H,14-15H2,(H2,23,26)/b10-4-,11-5+/t22-/m1/s1 |
| InChIKey | PQZYANFNYHRHDF-IISDVSGHSA-N |
| XLogP | 1.93 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|