C28H25NO3 — CID 27523916
(3R)-3-hydroxy-1-[(4-methylphenyl)methyl]-3-[(3E,5E)-2-oxo-6-phenylhexa-3,5-dienyl]indol-2-one (PubChem CID 27523916) has the molecular formula C28H25NO3 and a molecular weight of 423.51 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-[(4-methylphenyl)methyl]-3-[(3E,5E)-2-oxo-6-phenylhexa-3,5-dienyl]indol-2-one.
| Compound Name | (3R)-3-hydroxy-1-[(4-methylphenyl)methyl]-3-[(3E,5E)-2-oxo-6-phenylhexa-3,5-dienyl]indol-2-one |
|---|---|
| PubChem CID | 27523916 |
| Molecular Formula | C28H25NO3 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (3R)-3-hydroxy-1-[(4-methylphenyl)methyl]-3-[(3E,5E)-2-oxo-6-phenylhexa-3,5-dienyl]indol-2-one |
| SMILES | Cc1ccc(CN2C(=O)[C@@](O)(CC(=O)/C=C/C=C/c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H25NO3/c1-21-15-17-23(18-16-21)20-29-26-14-8-7-13-25(26)28(32,27(29)31)19-24(30)12-6-5-11-22-9-3-2-4-10-22/h2-18,32H,19-20H2,1H3/b11-5+,12-6+/t28-/m1/s1 |
| InChIKey | BZMBRHILMNRGPH-KMDHTVAXSA-N |
| XLogP | 4.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|