C23H20N2O3 — CID 7270821
(3R)-3-hydroxy-1-[(4-methylphenyl)methyl]-3-(2-oxo-2-pyridin-4-ylethyl)indol-2-one (PubChem CID 7270821) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-[(4-methylphenyl)methyl]-3-(2-oxo-2-pyridin-4-ylethyl)indol-2-one.
| Compound Name | (3R)-3-hydroxy-1-[(4-methylphenyl)methyl]-3-(2-oxo-2-pyridin-4-ylethyl)indol-2-one |
|---|---|
| PubChem CID | 7270821 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (3R)-3-hydroxy-1-[(4-methylphenyl)methyl]-3-(2-oxo-2-pyridin-4-ylethyl)indol-2-one |
| SMILES | Cc1ccc(CN2C(=O)[C@@](O)(CC(=O)c3ccncc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H20N2O3/c1-16-6-8-17(9-7-16)15-25-20-5-3-2-4-19(20)23(28,22(25)27)14-21(26)18-10-12-24-13-11-18/h2-13,28H,14-15H2,1H3/t23-/m1/s1 |
| InChIKey | IVGLNYMTMATRKP-HSZRJFAPSA-N |
| XLogP | 3.40 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |