C30H28N2O3 — CID 7106531
(3R)-3-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-oxoethyl]-3-hydroxy-1-[(4-methylphenyl)methyl]indol-2-one (PubChem CID 7106531) has the molecular formula C30H28N2O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is (3R)-3-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-oxoethyl]-3-hydroxy-1-[(4-methylphenyl)methyl]indol-2-one.
| Compound Name | (3R)-3-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-oxoethyl]-3-hydroxy-1-[(4-methylphenyl)methyl]indol-2-one |
|---|---|
| PubChem CID | 7106531 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | (3R)-3-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-2-oxoethyl]-3-hydroxy-1-[(4-methylphenyl)methyl]indol-2-one |
| SMILES | Cc1ccc(CN2C(=O)[C@@](O)(CC(=O)c3ccc(-n4c(C)ccc4C)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H28N2O3/c1-20-8-12-23(13-9-20)19-31-27-7-5-4-6-26(27)30(35,29(31)34)18-28(33)24-14-16-25(17-15-24)32-21(2)10-11-22(32)3/h4-17,35H,18-19H2,1-3H3/t30-/m1/s1 |
| InChIKey | CAGJQPNQUDIGST-SSEXGKCCSA-N |
| XLogP | 5.41 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|