C24H20BrNO3 — CID 1425799
(3R)-1-[(4-bromophenyl)methyl]-3-hydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]indol-2-one (PubChem CID 1425799) has the molecular formula C24H20BrNO3 and a molecular weight of 450.33 g/mol. Its IUPAC name is (3R)-1-[(4-bromophenyl)methyl]-3-hydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]indol-2-one.
| Compound Name | (3R)-1-[(4-bromophenyl)methyl]-3-hydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 1425799 |
| Molecular Formula | C24H20BrNO3 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | (3R)-1-[(4-bromophenyl)methyl]-3-hydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]indol-2-one |
| SMILES | Cc1ccc(C(=O)C[C@]2(O)C(=O)N(Cc3ccc(Br)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H20BrNO3/c1-16-6-10-18(11-7-16)22(27)14-24(29)20-4-2-3-5-21(20)26(23(24)28)15-17-8-12-19(25)13-9-17/h2-13,29H,14-15H2,1H3/t24-/m1/s1 |
| InChIKey | QHROLKXMXVHWPQ-XMMPIXPASA-N |
| XLogP | 4.76 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |