C25H19Cl2NO3 — CID 40875410
(3S)-5-chloro-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[(E)-2-oxo-4-phenylbut-3-enyl]indol-2-one (PubChem CID 40875410) has the molecular formula C25H19Cl2NO3 and a molecular weight of 452.34 g/mol. Its IUPAC name is (3S)-5-chloro-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[(E)-2-oxo-4-phenylbut-3-enyl]indol-2-one.
| Compound Name | (3S)-5-chloro-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[(E)-2-oxo-4-phenylbut-3-enyl]indol-2-one |
|---|---|
| PubChem CID | 40875410 |
| Molecular Formula | C25H19Cl2NO3 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | (3S)-5-chloro-1-[(4-chlorophenyl)methyl]-3-hydroxy-3-[(E)-2-oxo-4-phenylbut-3-enyl]indol-2-one |
| SMILES | O=C(/C=C/c1ccccc1)C[C@@]1(O)C(=O)N(Cc2ccc(Cl)cc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H19Cl2NO3/c26-19-9-6-18(7-10-19)16-28-23-13-11-20(27)14-22(23)25(31,24(28)30)15-21(29)12-8-17-4-2-1-3-5-17/h1-14,31H,15-16H2/b12-8+/t25-/m0/s1 |
| InChIKey | XMFJFNWHZGBXLV-ZQDAFOGCSA-N |
| XLogP | 5.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|