C26H20ClNO5 — CID 41339136
(3R)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-1-benzyl-5-chloro-3-hydroxyindol-2-one (PubChem CID 41339136) has the molecular formula C26H20ClNO5 and a molecular weight of 461.90 g/mol. Its IUPAC name is (3R)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-1-benzyl-5-chloro-3-hydroxyindol-2-one.
| Compound Name | (3R)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-1-benzyl-5-chloro-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 41339136 |
| Molecular Formula | C26H20ClNO5 |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | (3R)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-1-benzyl-5-chloro-3-hydroxyindol-2-one |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)C[C@]1(O)C(=O)N(Cc2ccccc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C26H20ClNO5/c27-19-8-10-22-21(13-19)26(31,25(30)28(22)15-18-4-2-1-3-5-18)14-20(29)9-6-17-7-11-23-24(12-17)33-16-32-23/h1-13,31H,14-16H2/b9-6+/t26-/m1/s1 |
| InChIKey | TYYXWRDQXNTVAW-KXZPLDGJSA-N |
| XLogP | 4.48 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|