C22H18BrNO5 — CID 4317840
3-[4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-5-bromo-3-hydroxy-1-prop-2-enylindol-2-one (PubChem CID 4317840) has the molecular formula C22H18BrNO5 and a molecular weight of 456.29 g/mol. Its IUPAC name is 3-[4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-5-bromo-3-hydroxy-1-prop-2-enylindol-2-one.
| Compound Name | 3-[4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-5-bromo-3-hydroxy-1-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 4317840 |
| Molecular Formula | C22H18BrNO5 |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 3-[4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-5-bromo-3-hydroxy-1-prop-2-enylindol-2-one |
| SMILES | C=CCN1C(=O)C(O)(CC(=O)C=Cc2ccc3c(c2)OCO3)c2cc(Br)ccc21 |
| InChI | InChI=1S/C22H18BrNO5/c1-2-9-24-18-7-5-15(23)11-17(18)22(27,21(24)26)12-16(25)6-3-14-4-8-19-20(10-14)29-13-28-19/h2-8,10-11,27H,1,9,12-13H2 |
| InChIKey | QFLBXZQJZPAUGK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|