C19H16BrNO4 — CID 7316061
(3R)-5-bromo-3-hydroxy-3-[2-(2-hydroxyphenyl)-2-oxoethyl]-1-prop-2-enylindol-2-one (PubChem CID 7316061) has the molecular formula C19H16BrNO4 and a molecular weight of 402.24 g/mol. Its IUPAC name is (3R)-5-bromo-3-hydroxy-3-[2-(2-hydroxyphenyl)-2-oxoethyl]-1-prop-2-enylindol-2-one.
| Compound Name | (3R)-5-bromo-3-hydroxy-3-[2-(2-hydroxyphenyl)-2-oxoethyl]-1-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 7316061 |
| Molecular Formula | C19H16BrNO4 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | (3R)-5-bromo-3-hydroxy-3-[2-(2-hydroxyphenyl)-2-oxoethyl]-1-prop-2-enylindol-2-one |
| SMILES | C=CCN1C(=O)[C@@](O)(CC(=O)c2ccccc2O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C19H16BrNO4/c1-2-9-21-15-8-7-12(20)10-14(15)19(25,18(21)24)11-17(23)13-5-3-4-6-16(13)22/h2-8,10,22,25H,1,9,11H2/t19-/m1/s1 |
| InChIKey | OGCVEGPXJAIUDE-LJQANCHMSA-N |
| XLogP | 3.15 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|