C22H22BrNO3 — CID 1255720
(3R)-5-bromo-3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1-prop-2-enylindol-2-one (PubChem CID 1255720) has the molecular formula C22H22BrNO3 and a molecular weight of 428.33 g/mol. Its IUPAC name is (3R)-5-bromo-3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1-prop-2-enylindol-2-one.
| Compound Name | (3R)-5-bromo-3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 1255720 |
| Molecular Formula | C22H22BrNO3 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | (3R)-5-bromo-3-hydroxy-3-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-1-prop-2-enylindol-2-one |
| SMILES | C=CCN1C(=O)[C@@](O)(CC(=O)c2cc(C)c(C)cc2C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C22H22BrNO3/c1-5-8-24-19-7-6-16(23)11-18(19)22(27,21(24)26)12-20(25)17-10-14(3)13(2)9-15(17)4/h5-7,9-11,27H,1,8,12H2,2-4H3/t22-/m1/s1 |
| InChIKey | JUFQHHYIILHTID-JOCHJYFZSA-N |
| XLogP | 4.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|